4-chloro-N-[(4-methoxyphenyl)methyl]aniline structure
|
Common Name | 4-chloro-N-[(4-methoxyphenyl)methyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 104329-18-2 | Molecular Weight | 247.72000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-N-(4-methoxybenzyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14ClNO |
|---|---|
| Molecular Weight | 247.72000 |
| Exact Mass | 247.07600 |
| PSA | 21.26000 |
| LogP | 4.03370 |
| InChIKey | HJXWKUCABPCBMP-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNc2ccc(Cl)cc2)cc1 |
| HS Code | 2922299090 |
|---|
|
~81%
4-chloro-N-[(4-... CAS#:104329-18-2 |
| Literature: Iranpoor, Nasser; Firouzabadi, Habib; Khalili, Dariush Bulletin of the Chemical Society of Japan, 2010 , vol. 83, # 8 p. 923 - 934 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-chloro-N-(4-methoxybenzyl)benzenamine |
| (4-CHLORO-PHENYL)-(4-METHOXY-BENZYL)-AMINE |
| 4-chloro-N-((4-methoxyphenyl)methyl)aniline |
| 4-Chloro-N-(4-methoxybenzyl)aniline |
| 4-chlorophenyl-4-methoxybenzylamine |
| p-chloro-N-(p-methoxybenzyl)aniline |
| N-(4-methoxybenzyl)-4-chlorobenzenamine |
| N-(4-methoxybenzyl)-4-chloroaniline |