Diphpetmednp
Modify Date: 2025-08-22 09:35:21
Diphpetmednp structure
|
Common Name | Diphpetmednp | ||
|---|---|---|---|---|
| CAS Number | 104305-93-3 | Molecular Weight | 608.68400 | |
| Density | 1.238g/cm3 | Boiling Point | 704ºC at 760mmHg | |
| Molecular Formula | C35H36N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 379.6ºC | |
| Name | 3-O-[2-(4-benzhydrylpiperazin-1-yl)ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 704ºC at 760mmHg |
| Molecular Formula | C35H36N4O6 |
| Molecular Weight | 608.68400 |
| Flash Point | 379.6ºC |
| Exact Mass | 608.26300 |
| PSA | 117.79000 |
| LogP | 6.02320 |
| Vapour Pressure | 1.15E-19mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | MZPQQVUYDSUMHF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)nc(C)c(C(=O)OCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c1-c1cccc([N+](=O)[O-])c1 |
|
~93%
Diphpetmednp CAS#:104305-93-3 |
| Literature: Meguro; Aizawa; Sohda; Kawamatsu; Nagaoka Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3787 - 3797 |
|
~%
Diphpetmednp CAS#:104305-93-3 |
| Literature: Meguro; Aizawa; Sohda; Kawamatsu; Nagaoka Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3787 - 3797 |
|
~%
Diphpetmednp CAS#:104305-93-3 |
| Literature: Meguro; Aizawa; Sohda; Kawamatsu; Nagaoka Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3787 - 3797 |
|
~%
Diphpetmednp CAS#:104305-93-3 |
| Literature: Meguro; Aizawa; Sohda; Kawamatsu; Nagaoka Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3787 - 3797 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| dehydro-manidipine |
| didehydromanidipine |
| Diphpetmednp |