bis(2,3,4,5,6-pentachlorophenyl)mercury
Modify Date: 2025-09-03 17:35:02
bis(2,3,4,5,6-pentachlorophenyl)mercury structure
|
Common Name | bis(2,3,4,5,6-pentachlorophenyl)mercury | ||
|---|---|---|---|---|
| CAS Number | 1043-49-8 | Molecular Weight | 699.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12Cl10Hg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2,3,4,5,6-pentachlorophenyl)mercury |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12Cl10Hg |
|---|---|
| Molecular Weight | 699.24800 |
| Exact Mass | 695.65900 |
| LogP | 8.25390 |
| InChIKey | LNHVTRXAXKOKSJ-UHFFFAOYSA-N |
| SMILES | Clc1c(Cl)c(Cl)c([Hg]c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Bis-pentachlor-phenyl-quecksilber |