1-propylxanthine structure
|
Common Name | 1-propylxanthine | ||
|---|---|---|---|---|
| CAS Number | 104285-82-7 | Molecular Weight | 194.19100 | |
| Density | 1.367g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-propyl-3,7-dihydropurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19100 |
| Exact Mass | 194.08000 |
| PSA | 83.80000 |
| LogP | 0.23520 |
| Index of Refraction | 1.583 |
| InChIKey | IWBONKMODGBEOX-UHFFFAOYSA-N |
| SMILES | CCCn1c(=O)[nH]c2nc[nH]c2c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| propylxanthine |
| 1H-Purine-2,6-dione,3,9-dihydro-1-propyl |
| 1-propyl xanthine |