Rilopirox structure
|
Common Name | Rilopirox | ||
|---|---|---|---|---|
| CAS Number | 104153-37-9 | Molecular Weight | 357.78800 | |
| Density | 1.347g/cm3 | Boiling Point | 532.2ºC at 760mmHg | |
| Molecular Formula | C19H16ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.7ºC | |
| Name | 6-[[4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 532.2ºC at 760mmHg |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.78800 |
| Flash Point | 275.7ºC |
| Exact Mass | 357.07700 |
| PSA | 60.69000 |
| LogP | 4.41870 |
| Vapour Pressure | 3.71E-12mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | UDYUIWXQUBNDHC-UHFFFAOYSA-N |
| SMILES | Cc1cc(COc2ccc(Oc3ccc(Cl)cc3)cc2)n(O)c(=O)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Rilopirox |
| UNII-595T4D0KQ3 |