methyl-phenyl-[2,4,6-tri(propan-2-yl)phenyl]phosphane structure
|
Common Name | methyl-phenyl-[2,4,6-tri(propan-2-yl)phenyl]phosphane | ||
|---|---|---|---|---|
| CAS Number | 104108-09-0 | Molecular Weight | 326.45500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H31P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl-phenyl-[2,4,6-tri(propan-2-yl)phenyl]phosphane |
|---|
| Molecular Formula | C22H31P |
|---|---|
| Molecular Weight | 326.45500 |
| Exact Mass | 326.21600 |
| PSA | 13.59000 |
| LogP | 6.11930 |
| InChIKey | UFEKECWEMSYPTQ-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(P(C)c2ccccc2)c(C(C)C)c1 |
|
~92%
methyl-phenyl-[... CAS#:104108-09-0 |
| Literature: Moncarz, Jillian R.; Laritcheva, Natalia F.; Glueck, David S. Journal of the American Chemical Society, 2002 , vol. 124, # 45 p. 13356 - 13357 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |