N-[3-(sec-Butoxy)phenyl]-N-{2-[2-(sec-butyl)-phenoxy]ethyl}amine
Modify Date: 2025-08-25 19:19:59
![N-[3-(sec-Butoxy)phenyl]-N-{2-[2-(sec-butyl)-phenoxy]ethyl}amine Structure](https://image.chemsrc.com/caspic/438/1040685-63-9.png)
N-[3-(sec-Butoxy)phenyl]-N-{2-[2-(sec-butyl)-phenoxy]ethyl}amine structure
|
Common Name | N-[3-(sec-Butoxy)phenyl]-N-{2-[2-(sec-butyl)-phenoxy]ethyl}amine | ||
|---|---|---|---|---|
| CAS Number | 1040685-63-9 | Molecular Weight | 341.48700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H31NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[3-(sec-Butoxy)phenyl]-N-{2-[2-(sec-butyl)-phenoxy]ethyl}amine |
|---|
| Molecular Formula | C22H31NO2 |
|---|---|
| Molecular Weight | 341.48700 |
| Exact Mass | 341.23500 |
| PSA | 30.49000 |
| LogP | 5.94130 |
| InChIKey | WEMFBHYPLAWRED-UHFFFAOYSA-N |
| SMILES | CCC(C)Oc1cccc(NCCOc2ccccc2C(C)CC)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |