2-(dimethylamino)ethyl 4-amino-2-butoxybenzoate structure
|
Common Name | 2-(dimethylamino)ethyl 4-amino-2-butoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 104068-16-8 | Molecular Weight | 280.36300 | |
| Density | 1.078g/cm3 | Boiling Point | 421.8ºC at 760 mmHg | |
| Molecular Formula | C15H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | 2-(dimethylamino)ethyl 4-amino-2-butoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.078g/cm3 |
|---|---|
| Boiling Point | 421.8ºC at 760 mmHg |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.36300 |
| Flash Point | 208.9ºC |
| Exact Mass | 280.17900 |
| PSA | 64.79000 |
| LogP | 2.74730 |
| Vapour Pressure | 2.53E-07mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | CVNZUXHXTUSZSR-UHFFFAOYSA-N |
| SMILES | CCCCOc1cc(N)ccc1C(=O)OCCN(C)C |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| S 812 |
| 4-Amino-2-n-butoxy-benzoesaeure-dimethylaminoaethylester |
| 2-dimethylaminoethyl 4-amino-2-butoxybenzoate |