dicamba-diglycolamine structure
|
Common Name | dicamba-diglycolamine | ||
|---|---|---|---|---|
| CAS Number | 104040-79-1 | Molecular Weight | 326.17300 | |
| Density | N/A | Boiling Point | 497.6ºC at 760mmHg | |
| Molecular Formula | C12H17Cl2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8ºC | |
| Name | dicamba-diglycolamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 497.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H17Cl2NO5 |
| Molecular Weight | 326.17300 |
| Flash Point | 254.8ºC |
| Exact Mass | 325.04800 |
| PSA | 102.01000 |
| LogP | 2.35450 |
| Vapour Pressure | 1.01E-10mmHg at 25°C |
| InChIKey | QURLONWWPWCPIC-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)O.NCCOCCO |
| 3,6-dichloro-o-anisic acid - 2-(2-aminoethoxy)ethanol (1:1) |
| Benzoic acid,3,6-dichloro-2-methoxy-,compd. with 2-(2-aminoethoxy)ethanol (1:1) |
| 3,6-dichloro-2-methoxybenzoic acid - 2-(2-aminoethoxy)ethanol (1:1) |
| Benzoic acid,3,6-dichloro-2-methoxy-,compound with 2-(2-aminoethoxy)ethanol (1:1) |
| 3,6-dichloro-2-methoxybenzoic acid compound with 2-(2-aminoethoxy)ethanol (1:1) |
| diglycolamine |
| 2-(2-aminoethoxy)ethanol,3,6-dichloro-2-methoxybenzoic acid |
| 3,6-dichloro-2-methoxybenzoic acid—2-(2-aminoethoxy)ethan-1-ol |
| [2-(2-hydroxyethoxy)ethyl]ammonium 3,6-dichloro-2-methoxybenzoate |
| [2-(2-hydroxyethoxy)ethyl]ammonium 3,6-dichloro-o-anisate |
| Dicamba diglycolamine salt |