6-Chloro-2-(4-methylphenyl)quinoline-4-carboxylic acid structure
|
Common Name | 6-Chloro-2-(4-methylphenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 103914-61-0 | Molecular Weight | 297.73600 | |
| Density | 1.336g/cm3 | Boiling Point | 490.7ºC at 760 mmHg | |
| Molecular Formula | C17H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.6ºC | |
| Name | 6-Chloro-2-(4-methylphenyl)quinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 490.7ºC at 760 mmHg |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.73600 |
| Flash Point | 250.6ºC |
| Exact Mass | 297.05600 |
| PSA | 50.19000 |
| LogP | 4.56180 |
| Vapour Pressure | 1.91E-10mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | JYXFXXNOTATROZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cc(C(=O)O)c3cc(Cl)ccc3n2)cc1 |
| HS Code | 2933499090 |
|---|
|
~53%
6-Chloro-2-(4-m... CAS#:103914-61-0 |
| Literature: Das, Priyabrata; Deng, Xiaoyi; Zhang, Liang; Roth, Michael G.; Fontoura, Beatriz M.A.; Phillips, Margaret A.; De Brabander, Jef K. ACS Medicinal Chemistry Letters, 2013 , vol. 4, # 6 p. 517 - 521 |
|
~%
6-Chloro-2-(4-m... CAS#:103914-61-0 |
| Literature: Chemical Communications, , # 10 p. 1036 - 1037 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-2-p-tolyl-quinoline-4-carboxylic acid |
| BB_SC-1463 |
| 6-Chlor-2-p-tolyl-chinolin-4-carbonsaeure |