1-(3,4-Dinitrophenyl)ethanone structure
|
Common Name | 1-(3,4-Dinitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 10387-05-0 | Molecular Weight | 210.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,4-Dinitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6N2O5 |
|---|---|
| Molecular Weight | 210.14400 |
| Exact Mass | 210.02800 |
| PSA | 108.71000 |
| LogP | 2.75200 |
| InChIKey | NRWMSJRLIZWNTJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Methanone,(3,4-dinitrophenyl)(4-fluorophenyl) |
| 3,4-dinitroacetophenone |