2-chloro-4-acetamidoacetophenone
Modify Date: 2025-09-09 13:37:28
2-chloro-4-acetamidoacetophenone structure
|
Common Name | 2-chloro-4-acetamidoacetophenone | ||
|---|---|---|---|---|
| CAS Number | 103273-72-9 | Molecular Weight | 211.64500 | |
| Density | 1.274 g/cm3 | Boiling Point | 382.9ºC at 760 mmHg | |
| Molecular Formula | C10H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.4ºC | |
| Name | N-(4-acetyl-3-chlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274 g/cm3 |
|---|---|
| Boiling Point | 382.9ºC at 760 mmHg |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.64500 |
| Flash Point | 185.4ºC |
| Exact Mass | 211.04000 |
| PSA | 46.17000 |
| LogP | 2.57400 |
| InChIKey | XUQMKUAJGHLWEP-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(C)=O)c(Cl)c1 |
|
~%
2-chloro-4-acet... CAS#:103273-72-9 |
| Literature: Mehta; Patel Journal of the Indian Chemical Society, 1959 , vol. 36, p. 99,101 |
| acetic acid-(4-acetyl-3-chloro-anilide) |
| Acetanilide,4'-acetyl-3'-chloro-(6CI) |
| N-(3-chloranyl-4-ethanoyl-phenyl)ethanamide |
| Acetamide,N-(4-acetyl-3-chlorophenyl) |
| Essigsaeure-(4-acetyl-3-chlor-anilid) |