6-nitro-1-(1-piperidylmethyl)benzoimidazole structure
|
Common Name | 6-nitro-1-(1-piperidylmethyl)benzoimidazole | ||
|---|---|---|---|---|
| CAS Number | 103248-18-6 | Molecular Weight | 260.29200 | |
| Density | 1.38g/cm3 | Boiling Point | 434.9ºC at 760mmHg | |
| Molecular Formula | C13H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.8ºC | |
| Name | 6-nitro-1-(piperidin-1-ylmethyl)benzimidazole |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 434.9ºC at 760mmHg |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.29200 |
| Flash Point | 216.8ºC |
| Exact Mass | 260.12700 |
| PSA | 66.88000 |
| LogP | 2.84900 |
| Vapour Pressure | 9.16E-08mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | WFRNJCRDTRVMHU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2ncn(CN3CCCCC3)c2c1 |
|
~83%
6-nitro-1-(1-pi... CAS#:103248-18-6 |
| Literature: Kumar, B. Vijaya; Rao, A. Bhaskar; Reddy, V. Malla Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 889 - 892 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |