UNII:2FZ7LD4B44
UNII:2FZ7LD4B44 structure
|
Common Name | UNII:2FZ7LD4B44 | ||
|---|---|---|---|---|
| CAS Number | 103146-25-4 | Molecular Weight | 342.407 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 537.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H23FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.7±30.1 °C | |
| Name | 4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 537.2±50.0 °C at 760 mmHg |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.407 |
| Flash Point | 278.7±30.1 °C |
| Exact Mass | 342.174347 |
| PSA | 67.49000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | GNULRNVWXYXBQY-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC(O)(c1ccc(F)cc1)c1ccc(C#N)cc1CO |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2926909090 |
|
~%
UNII:2FZ7LD4B44 CAS#:103146-25-4 |
| Literature: US2010/249438 A1, ; Page/Page column 4 ; |
|
~%
UNII:2FZ7LD4B44 CAS#:103146-25-4 |
| Literature: WO2006/106531 A1, ; Page/Page column 11 ; |
|
~%
UNII:2FZ7LD4B44 CAS#:103146-25-4 |
| Literature: EP1700851 A1, ; Page/Page column 9 ; |
|
~%
UNII:2FZ7LD4B44 CAS#:103146-25-4 |
| Literature: WO2005/77927 A1, ; Page/Page column 10-11 ; |
|
~92%
UNII:2FZ7LD4B44 CAS#:103146-25-4 |
| Literature: Zong, Hua; Huang, Huayin; Liu, Junfeng; Bian, Guangling; Song, Ling Journal of Organic Chemistry, 2012 , vol. 77, # 10 p. 4645 - 4652 |
|
~%
UNII:2FZ7LD4B44 CAS#:103146-25-4 |
| Literature: US2011/92719 A1, ; |
|
~%
UNII:2FZ7LD4B44 CAS#:103146-25-4 |
| Literature: US2011/92719 A1, ; |
![4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile hydrobromide structure](https://image.chemsrc.com/caspic/222/103146-26-5.png)
![4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile hydrochloride structure](https://image.chemsrc.com/caspic/091/717133-25-0.png)
| Precursor 8 | |
|---|---|
| DownStream 6 | |
CAS#:488787-59-3
CAS#:59729-32-7
CAS#:59729-33-8![1-[3-(Dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-5-isobenzofurancarboxamide structure](https://image.chemsrc.com/caspic/082/64372-56-1.png)
CAS#:64372-56-1
CAS#:128196-01-0
CAS#:219861-08-2| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Citadiol |
| (RS)-(+/-)-4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxy-1-butyl]-3-(hydroxymethyl)benzonitrile |
| UNII:2FZ7LD4B44 |
| Q1R CCN FXQR DF&3N1&1 |
| 4-[(S)-4-N,N-Dimethylamino-1-(4-fluoro-phenyl)-1-hydroxy-butyl]-3-hydroxymethyl-benzonitrile |
| UNII-2FZ7LD4B44 |
| 4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile |
| Benzonitrile, 4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)- |
| Benzonitrile,4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl) |
| 4-[4-(dimethylamino)-1-(4'-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile diol |
| 4-(4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile |
| (RS)-4-(4-Dimethylamino-1-(4-fluorophenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitrile |