4-Piperidinecarboxamide,1-(phenylmethyl)-4-(propylamino)- structure
|
Common Name | 4-Piperidinecarboxamide,1-(phenylmethyl)-4-(propylamino)- | ||
|---|---|---|---|---|
| CAS Number | 1031-37-4 | Molecular Weight | 275.38900 | |
| Density | 1.09g/cm3 | Boiling Point | 444.4ºC at 760mmHg | |
| Molecular Formula | C16H25N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.5ºC | |
| Name | 1-benzyl-4-(propylamino)piperidine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 444.4ºC at 760mmHg |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.38900 |
| Flash Point | 222.5ºC |
| Exact Mass | 275.20000 |
| PSA | 58.36000 |
| LogP | 2.53520 |
| Vapour Pressure | 4.31E-08mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | SXXNRWUIGQVITE-UHFFFAOYSA-N |
| SMILES | CCCNC1(C(N)=O)CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzyl-4-carbamoyl-4-propylamino-piperidin |