3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride
Modify Date: 2025-09-10 10:20:49
3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride structure
|
Common Name | 3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 103011-38-7 | Molecular Weight | 254.71100 | |
| Density | 1.58g/cm3 | Boiling Point | 365.3ºC at 760mmHg | |
| Molecular Formula | C7H7ClO4S2 | Melting Point | 93ºC | |
| MSDS | USA | Flash Point | 174.7ºC | |
| Name | 3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 365.3ºC at 760mmHg |
| Melting Point | 93ºC |
| Molecular Formula | C7H7ClO4S2 |
| Molecular Weight | 254.71100 |
| Flash Point | 174.7ºC |
| Exact Mass | 253.94700 |
| PSA | 89.22000 |
| LogP | 2.80180 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | RRTOURREASJQSR-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1sccc1C1OCCO1 |
|
~%
3-(1,3-dioxolan... CAS#:103011-38-7 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4659369 A1, 1987 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-(1,3-dioxolan-2-yl)-thiophene-2-sulfonyl chloride |
| chloro(3-(1,3-dioxolan-2-yl)(2-thienyl))sulfone |