Guanosine, 3'-O-methyl- structure
|
Common Name | Guanosine, 3'-O-methyl- | ||
|---|---|---|---|---|
| CAS Number | 10300-27-3 | Molecular Weight | 297.26700 | |
| Density | 1.98g/cm3 | Boiling Point | 711.7ºC at 760mmHg | |
| Molecular Formula | C11H15N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 384.2ºC | |
Use of Guanosine, 3'-O-methyl-3'-O-Methylguanosine is a methylated nucleoside analogs and a RNA chain terminator. 3'-O-methylguanosine can inhibit early virus-specific RNA synthesis[1]. |
| Name | 3'-O-methylguanosine |
|---|---|
| Synonym | More Synonyms |
| Description | 3'-O-Methylguanosine is a methylated nucleoside analogs and a RNA chain terminator. 3'-O-methylguanosine can inhibit early virus-specific RNA synthesis[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.98g/cm3 |
|---|---|
| Boiling Point | 711.7ºC at 760mmHg |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.26700 |
| Flash Point | 384.2ºC |
| Exact Mass | 297.10700 |
| PSA | 148.51000 |
| Vapour Pressure | 2.93E-21mmHg at 25°C |
| Index of Refraction | 1.829 |
| InChIKey | UYARPHAXAJAZLU-KQYNXXCUSA-N |
| SMILES | COC1C(CO)OC(n2cnc3c(=O)[nH]c(N)nc32)C1O |
| Hazard Codes | Xi |
|---|
| 2-amino-9-[3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-3H-purin-6-one |
| 3'-O-methyl-guanosine |
| 3'-O-Methylguanosin |
| 3'-OMe-G |
| O3'-methyl-guanosine |