[(5E)-10-propyltrideca-5,9-dienyl] acetate structure
|
Common Name | [(5E)-10-propyltrideca-5,9-dienyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 10297-61-7 | Molecular Weight | 280.44500 | |
| Density | 0.887g/cm3 | Boiling Point | 365.5ºC at 760mmHg | |
| Molecular Formula | C18H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102ºC | |
| Name | [(5E)-10-propyltrideca-5,9-dienyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.887g/cm3 |
|---|---|
| Boiling Point | 365.5ºC at 760mmHg |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.44500 |
| Flash Point | 102ºC |
| Exact Mass | 280.24000 |
| PSA | 26.30000 |
| LogP | 5.58280 |
| Vapour Pressure | 1.57E-05mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | CZXDHMZKNAOPHQ-VOTSOKGWSA-N |
| SMILES | CCCC(=CCCC=CCCCCOC(C)=O)CCC |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 10-Propyl-trans-5,9-tridecadienyl acetate |
| trans-1-Acetoxy-10-(n-propyl)-trideca-5,9-dien (Propylur) |
| (5E)-10-Propyl-5,9-tridecadienyl acetate |
| trans-10-n-Propyl-5,9-tridecadienylacetat |
| 5,9-Tridecadien-1-ol,10-propyl-,acetate |
| 1-Acetoxy-10-n-propyl-trans-5.9-tridecadien |
| 5,9-Tridecadien-1-ol,10-propyl-,acetate,(E) |
| Propylure |
| 1-Acetoxy-10-propyl-tridecadien-(5t,9) |
| trans-1-Acetoxy-10-propyl-tridecadien-(5,9) |