3,4-dichloro-N-(3,4-dichlorophenyl)benzamide structure
|
Common Name | 3,4-dichloro-N-(3,4-dichlorophenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 10286-79-0 | Molecular Weight | 335.01300 | |
| Density | 1.55g/cm3 | Boiling Point | 382.2ºC at 760 mmHg | |
| Molecular Formula | C13H7Cl4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
| Name | 3,4-dichloro-N-(3,4-dichlorophenyl)benzamide |
|---|
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 382.2ºC at 760 mmHg |
| Molecular Formula | C13H7Cl4NO |
| Molecular Weight | 335.01300 |
| Flash Point | 185ºC |
| Exact Mass | 332.92800 |
| PSA | 29.10000 |
| LogP | 5.62550 |
| Vapour Pressure | 4.79E-06mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | QAANZVLFRHSOOU-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~76%
3,4-dichloro-N-... CAS#:10286-79-0 |
| Literature: Van Den Nieuwendijk, Adrianus M. C. H.; Pietra, Daniele; Heitman, Laura; Goeblyoes, Aniko; IJzerman, Adriaan P. Journal of Medicinal Chemistry, 2004 , vol. 47, # 3 p. 663 - 672 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |