2-[nitroso(phenylmethyl)amino]benzoic acid structure
|
Common Name | 2-[nitroso(phenylmethyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1028-91-7 | Molecular Weight | 256.25700 | |
| Density | 1.22g/cm3 | Boiling Point | 487ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.3ºC | |
| Name | 2-[benzyl(nitroso)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 487ºC at 760 mmHg |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.25700 |
| Flash Point | 248.3ºC |
| Exact Mass | 256.08500 |
| PSA | 69.97000 |
| LogP | 3.07280 |
| Vapour Pressure | 2.68E-10mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | VXZOBNZOEBYBFR-UHFFFAOYSA-N |
| SMILES | O=NN(Cc1ccccc1)c1ccccc1C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
2-[nitroso(phen... CAS#:1028-91-7 |
| Literature: Baiocchi,Leandro; Picconi, Giuseppe Tetrahedron Letters, 1983 , vol. 24, # 34 p. 3651 - 3652 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-[NITROSOBENZYLAMINO]BENZOIC ACID |
| EINECS 213-844-1 |
| N-Nitroso-N-benzyl anthranilic acid |
| N-Benzyl-N-nitroso-anthranilsaeure |
| 2-(Nitroso(phenylmethyl)amino)benzoic acid |