[dimethyl(phenyl)silyl]methyl-dimethyl-phenylsilane structure
|
Common Name | [dimethyl(phenyl)silyl]methyl-dimethyl-phenylsilane | ||
|---|---|---|---|---|
| CAS Number | 1027-86-7 | Molecular Weight | 284.54300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [dimethyl(phenyl)silyl]methyl-dimethyl-phenylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H24Si2 |
|---|---|
| Molecular Weight | 284.54300 |
| Exact Mass | 284.14200 |
| LogP | 3.75680 |
| InChIKey | HQHYZEXRRDTZOY-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C[Si](C)(C)c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| bis(methylchlorosilyl)methane |
| Silane,methylenebis[dimethylphenyl |
| Bis(phenyldimethylsilyl)-methan |
| Si,Si,Si',Si'-Tetramethyl-Si,Si'-diphenyl-Si,Si'-methandiyl-bis-silan |
| bis<phenyl(dimethyl)silyl>methane |
| Si,Si,Si',Si'-tetramethyl-Si,Si'-diphenyl-Si,Si'-methanediyl-bis-silane |
| Bis-(dimethyl-phenyl-silyl)-methan |