CHEMBRDG-BB 7113928 structure
|
Common Name | CHEMBRDG-BB 7113928 | ||
|---|---|---|---|---|
| CAS Number | 102677-62-3 | Molecular Weight | 240.68600 | |
| Density | 1.272g/cm3 | Boiling Point | 537.9ºC at 760 mmHg | |
| Molecular Formula | C11H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.1ºC | |
| Name | N-[(4-acetamidophenyl)methyl]-2-chloroacetamide |
|---|
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 537.9ºC at 760 mmHg |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.68600 |
| Flash Point | 279.1ºC |
| Exact Mass | 240.06700 |
| PSA | 58.20000 |
| LogP | 1.96390 |
| Vapour Pressure | 1.22E-11mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | LKTHYGFQEGMNRP-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(CNC(=O)CCl)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
CHEMBRDG-BB 7113928 CAS#:102677-62-3 |
| Literature: Kraska, Jan; Teodorczyk, Zygmunt Polish Journal of Chemistry, 1984 , vol. 58, # 10-12 p. 1025 - 1034 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |