Labdanolic acid
Modify Date: 2025-08-24 19:16:38
Labdanolic acid structure
|
Common Name | Labdanolic acid | ||
|---|---|---|---|---|
| CAS Number | 10267-24-0 | Molecular Weight | 324.5 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 439.3±18.0 °C at 760 mmHg | |
| Molecular Formula | C20H36O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 233.6±17.7 °C | |
Use of Labdanolic acidDescription Labdanolic acid is a key constituent of the acid fraction ofCistus ladaniferus. It is an easily isolable natural product. |
| Name | Labdanolic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 439.3±18.0 °C at 760 mmHg |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.5 |
| Flash Point | 233.6±17.7 °C |
| Exact Mass | 324.266449 |
| LogP | 5.80 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | KHCCSRVJJDOANA-ZOSGAXDSSA-N |
| SMILES | CC(CCC1C(C)(O)CCC2C(C)(C)CCCC21C)CC(=O)O |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| MFCD24849329 |