5-chloro-2-methyl-8-nitroquinoline structure
|
Common Name | 5-chloro-2-methyl-8-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 102653-54-3 | Molecular Weight | 222.62800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-2-methyl-8-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7ClN2O2 |
|---|---|
| Molecular Weight | 222.62800 |
| Exact Mass | 222.02000 |
| PSA | 58.71000 |
| LogP | 3.62800 |
| InChIKey | ZFLLHMUWSVFKDE-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(Cl)ccc([N+](=O)[O-])c2n1 |
|
~%
5-chloro-2-meth... CAS#:102653-54-3 |
| Literature: Sen; Basu Journal of the Indian Chemical Society, 1957 , vol. 34, p. 836 |
|
~%
5-chloro-2-meth... CAS#:102653-54-3 |
| Literature: Sen; Basu Journal of the Indian Chemical Society, 1957 , vol. 34, p. 836 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Quinoline,5-chloro-2-methyl-8-nitro |
| 5-chloro-2-methyl-8-nitro-quinoline |
| 5-Chlor-2-methyl-8-nitro-chinolin |