1,5-dimethyl-3-phenylpyrazole structure
|
Common Name | 1,5-dimethyl-3-phenylpyrazole | ||
|---|---|---|---|---|
| CAS Number | 10250-60-9 | Molecular Weight | 172.22600 | |
| Density | 1.03g/cm3 | Boiling Point | 281.7ºC at 760mmHg | |
| Molecular Formula | C11H12N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.2ºC | |
| Name | 1,5-dimethyl-3-phenylpyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 281.7ºC at 760mmHg |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.22600 |
| Flash Point | 124.2ºC |
| Exact Mass | 172.10000 |
| PSA | 17.82000 |
| LogP | 2.39550 |
| Vapour Pressure | 0.00599mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | AVZWCCJQQCROGD-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccc2)nn1C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,5-dimethyl-3-phenyl-pyrazole |
| 1,5-Dimethyl-3-phenyl-1H-pyrazol |
| 1,5-dimethyl-3-phenyl-1H-pyrazole |
| InChI=1/C11H12N2/c1-9-8-11(12-13(9)2)10-6-4-3-5-7-10/h3-8H,1-2H |
| 1H-Pyrazole,1,5-dimethyl-3-phenyl |