butyl N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]carbamate structure
|
Common Name | butyl N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 102417-15-2 | Molecular Weight | 324.41500 | |
| Density | 1.11g/cm3 | Boiling Point | 445.5ºC at 760mmHg | |
| Molecular Formula | C17H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.2ºC | |
| Name | butyl N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 445.5ºC at 760mmHg |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.41500 |
| Flash Point | 223.2ºC |
| Exact Mass | 324.20500 |
| PSA | 79.82000 |
| LogP | 3.23680 |
| Vapour Pressure | 1.02E-08mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | RZDKIUOYPNNXEV-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)Nc1ccc(OCC(O)CNC(C)C)cc1 |
|
~%
butyl N-[4-[2-h... CAS#:102417-15-2 |
| Literature: European Journal of Medicinal Chemistry, , vol. 26, # 9 p. 843 - 851 |
|
~%
butyl N-[4-[2-h... CAS#:102417-15-2 |
| Literature: European Journal of Medicinal Chemistry, , vol. 26, # 9 p. 843 - 851 |
|
~%
butyl N-[4-[2-h... CAS#:102417-15-2 |
| Literature: European Journal of Medicinal Chemistry, , vol. 26, # 9 p. 843 - 851 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| butyl{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}carbamate |
| Carbamic acid,[4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]-,butyl ester (9CI) |