dichloromethyl-[4-(dichloromethyl-λ2-silanyl)naphthalen-1-yl]silicon
Modify Date: 2025-11-26 09:12:47
![dichloromethyl-[4-(dichloromethyl-λ2-silanyl)naphthalen-1-yl]silicon Structure](https://image.chemsrc.com/caspic/173/1024-48-2.png)
dichloromethyl-[4-(dichloromethyl-λ2-silanyl)naphthalen-1-yl]silicon structure
|
Common Name | dichloromethyl-[4-(dichloromethyl-λ2-silanyl)naphthalen-1-yl]silicon | ||
|---|---|---|---|---|
| CAS Number | 1024-48-2 | Molecular Weight | 350.17500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Cl4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dichloromethyl-[4-(dichloromethyl-λ2-silanyl)naphthalen-1-yl]silicon |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8Cl4Si2 |
|---|---|
| Molecular Weight | 350.17500 |
| Exact Mass | 347.89200 |
| LogP | 3.86100 |
| InChIKey | UTCPMTRTTTWNQV-UHFFFAOYSA-N |
| SMILES | ClC(Cl)[Si]c1ccc([Si]C(Cl)Cl)c2ccccc12 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silane,1,4-naphthalenediylbis[dichloromethyl |
| 1.4-Bis-(dichlor-methyl-silyl)-naphthalin |