2,9-dimethyl-1,10-Phenanthroline-5,6-Dione structure
|
Common Name | 2,9-dimethyl-1,10-Phenanthroline-5,6-Dione | ||
|---|---|---|---|---|
| CAS Number | 102331-54-4 | Molecular Weight | 238.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,9-dimethyl-1,10-phenanthroline-5,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10N2O2 |
|---|---|
| Molecular Weight | 238.24100 |
| Exact Mass | 238.07400 |
| PSA | 59.92000 |
| LogP | 2.13940 |
| InChIKey | VNAPNEVIDUOCSG-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(n1)-c1nc(C)ccc1C(=O)C2=O |
|
~87%
2,9-dimethyl-1,... CAS#:102331-54-4 |
| Literature: Tetrahedron Letters, , vol. 49, # 42 p. 6054 - 6057 |
|
~%
2,9-dimethyl-1,... CAS#:102331-54-4 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 1 p. 75 - 82 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,10-Phenanthroline-5,6-dione,2,9-dimethyl |