1-chloro-4-(2-diethoxyphosphorylethenyl)benzene
Modify Date: 2025-09-15 16:39:33
1-chloro-4-(2-diethoxyphosphorylethenyl)benzene structure
|
Common Name | 1-chloro-4-(2-diethoxyphosphorylethenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 1023-63-8 | Molecular Weight | 274.68000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16ClO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-(2-diethoxyphosphorylethenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16ClO3P |
|---|---|
| Molecular Weight | 274.68000 |
| Exact Mass | 274.05300 |
| PSA | 45.34000 |
| LogP | 4.57680 |
| InChIKey | SWYVCFGKNSHNDR-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C=Cc1ccc(Cl)cc1)OCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| p-Chlorostyrylphosphonsaeure-diethylester |
| Phosphonic acid,[2-(4-chlorophenyl)ethenyl]-,diethyl ester |
| diethyl <2-(4-chlorophenyl)ethenyl>phosphonate |