4-AMINO-7-NITRO-2,1,3-BENZOXADIAZOLE structure
|
Common Name | 4-AMINO-7-NITRO-2,1,3-BENZOXADIAZOLE | ||
|---|---|---|---|---|
| CAS Number | 10199-91-4 | Molecular Weight | 180.12100 | |
| Density | 1.684g/cm3 | Boiling Point | 445.6ºC at 760 mmHg | |
| Molecular Formula | C6H4N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
Use of 4-AMINO-7-NITRO-2,1,3-BENZOXADIAZOLENBD-amine is a fluorogenic amine. NBD-amine displays the property of fluorescing weakly in water and strongly in organic solvents, membranes or hydrophobic environments[1]. |
| Name | 4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| Synonym | More Synonyms |
| Description | NBD-amine is a fluorogenic amine. NBD-amine displays the property of fluorescing weakly in water and strongly in organic solvents, membranes or hydrophobic environments[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.684g/cm3 |
|---|---|
| Boiling Point | 445.6ºC at 760 mmHg |
| Molecular Formula | C6H4N4O3 |
| Molecular Weight | 180.12100 |
| Flash Point | 223.3ºC |
| Exact Mass | 180.02800 |
| PSA | 110.76000 |
| LogP | 1.81760 |
| Vapour Pressure | 3.88E-08mmHg at 25°C |
| Index of Refraction | 1.745 |
| InChIKey | YXKOGLINWAPXPE-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])c2nonc12 |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Amino-7-nitrobenzofurazan |
| 4-amino-7-nitro-2,1,3-benzoxadiazole |
| 4-amino-7-nitrobenz-2-oxa-1,3-diazole |
| 7-nitrobenzo[c][1,2,5]oxadiazol-4-amine |
| 7-nitro-2,1,3-benzoxadiazol-4-amine |
| 7-nitrobenzo[c]1,2,5-oxadiazole-4-ylamine |
| 4-amino-7-nitrobenzo[c][1,2,5]oxadiazole |
| 7-amino 4-nitro 2-oxa 1,3-benzodiazole |
| 4-Amino-7-nitrobenzofurazane |
| 7-nitrobenz[c][1,2,5]oxadiazole-4-amine |