2-(1,2-dimethylindol-3-yl)-N,N-dimethyl-2-oxoacetamide
Modify Date: 2025-09-28 13:39:02
2-(1,2-dimethylindol-3-yl)-N,N-dimethyl-2-oxoacetamide structure
|
Common Name | 2-(1,2-dimethylindol-3-yl)-N,N-dimethyl-2-oxoacetamide | ||
|---|---|---|---|---|
| CAS Number | 101938-54-9 | Molecular Weight | 244.28900 | |
| Density | 1.14g/cm3 | Boiling Point | 412.5ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.2ºC | |
| Name | 2-(1,2-dimethylindol-3-yl)-N,N-dimethyl-2-oxoacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 412.5ºC at 760 mmHg |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.28900 |
| Flash Point | 203.2ºC |
| Exact Mass | 244.12100 |
| PSA | 42.31000 |
| LogP | 1.75760 |
| Vapour Pressure | 5.17E-07mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | DBKPULKMVOBTFA-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)C(=O)N(C)C)c2ccccc2n1C |
|
~%
2-(1,2-dimethyl... CAS#:101938-54-9 |
| Literature: Journal of the Chemical Society, , p. 3388,3396 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| F0675-0471 |
| (1,2-Dimethyl-indol-3-yl)-glyoxylsaeure-dimethylamid |
| INDOLE-3-GLYOXYLAMIDE,N,N,1,2-TETRAMETHYL |
| (1,2-dimethyl-indol-3-yl)-glyoxylic acid dimethylamide |
| N,N,1,2-Tetramethylindole-3-glyoxylamide |