Propanedioic acid,2-(1H-indol-3-ylmethylene)-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-(1H-indol-3-ylmethylene)-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 10184-96-0 | Molecular Weight | 287.31000 | |
| Density | 1.237g/cm3 | Boiling Point | 422.7ºC at 760mmHg | |
| Molecular Formula | C16H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.5ºC | |
| Name | diethyl 2-(1H-indol-3-ylmethylidene)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 422.7ºC at 760mmHg |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31000 |
| Flash Point | 209.5ºC |
| Exact Mass | 287.11600 |
| PSA | 68.39000 |
| LogP | 2.67750 |
| Vapour Pressure | 2.36E-07mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | PFJFOJBUEHKUCE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1c[nH]c2ccccc12)C(=O)OCC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| indol-3-ylmethylene-malonic acid diethyl ester |
| Indol-3-ylmethylen-malonsaeure-diaethylester |