3-[(4-methylpiperazin-1-yl)methyl]-1H-indole-5-carbonitrile
Modify Date: 2025-09-06 17:46:43
![3-[(4-methylpiperazin-1-yl)methyl]-1H-indole-5-carbonitrile Structure](https://image.chemsrc.com/caspic/042/101831-78-1.png)
3-[(4-methylpiperazin-1-yl)methyl]-1H-indole-5-carbonitrile structure
|
Common Name | 3-[(4-methylpiperazin-1-yl)methyl]-1H-indole-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 101831-78-1 | Molecular Weight | 254.33000 | |
| Density | 1.23g/cm3 | Boiling Point | 452.4ºC at 760mmHg | |
| Molecular Formula | C15H18N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.4ºC | |
| Name | 3-[(4-methylpiperazin-1-yl)methyl]-1H-indole-5-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 452.4ºC at 760mmHg |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.33000 |
| Flash Point | 227.4ºC |
| Exact Mass | 254.15300 |
| PSA | 46.06000 |
| LogP | 1.66278 |
| Vapour Pressure | 2.25E-08mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | PVNWVAMWFWITOQ-UHFFFAOYSA-N |
| SMILES | CN1CCN(Cc2c[nH]c3ccc(C#N)cc23)CC1 |
|
~84%
3-[(4-methylpip... CAS#:101831-78-1 |
| Literature: Khan, Khalid Mohammed; Rahim, Fazal; Ambreen, Nida; Taha, Muhammad; Iqbal, Sarosh; Haider, Syed Moazzam; Perveen, Shahnaz Journal of the Chemical Society of Pakistan, 2012 , vol. 34, # 3 p. 748 - 757 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-[(4-methyl-1-piperazinyl)methyl]-1H-indole-5-carbonitrile |
| 3-(4-Methyl-1-piperazinyl)methylindole-5-carbonitrile |
| 5-Cyano-3-(N-methylpiperazinomethyl)indole |
| INDOLE-5-CARBONITRILE,3-(4-METHYL-1-PIPERAZINYLMETHYL) |