(2-methyl-2,3-dihydro-1H-indol-1-yl)(oxo)acetic acid
Modify Date: 2025-09-12 00:09:54
(2-methyl-2,3-dihydro-1H-indol-1-yl)(oxo)acetic acid structure
|
Common Name | (2-methyl-2,3-dihydro-1H-indol-1-yl)(oxo)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1018295-36-7 | Molecular Weight | 205.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoacetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11NO3 |
|---|---|
| Molecular Weight | 205.21000 |
| Exact Mass | 205.07400 |
| PSA | 57.61000 |
| LogP | 1.11380 |
| InChIKey | JGESGOYJOOYVIT-UHFFFAOYSA-N |
| SMILES | CC1Cc2ccccc2N1C(=O)C(=O)O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (2-methyl-2,3-dihydro-1h-indol-1-yl)-(oxo)acetic acid |