2-(3-Chlorophenyl)-4-(diisopropylamino)butanoic acid
Modify Date: 2025-08-26 11:05:00
2-(3-Chlorophenyl)-4-(diisopropylamino)butanoic acid structure
|
Common Name | 2-(3-Chlorophenyl)-4-(diisopropylamino)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1017789-44-4 | Molecular Weight | 297.82000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-Chlorophenyl)-4-(diisopropylamino)butanoic acid |
|---|
| Molecular Formula | C16H24ClNO2 |
|---|---|
| Molecular Weight | 297.82000 |
| Exact Mass | 297.15000 |
| PSA | 40.54000 |
| LogP | 4.01710 |
| InChIKey | FQBWGRNRYQNBHR-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCC(C(=O)O)c1cccc(Cl)c1)C(C)C |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |