2-fluoro-4,6-bis(trifluoromethyl)benzoyl chloride structure
|
Common Name | 2-fluoro-4,6-bis(trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1017778-34-5 | Molecular Weight | 294.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H2ClF7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-fluoro-4,6-bis(trifluoromethyl)benzoyl chloride |
|---|
| Molecular Formula | C9H2ClF7O |
|---|---|
| Molecular Weight | 294.55 |
| Appearance of Characters | liquid | Colourless |
| InChIKey | RBJVFNYOFYHETI-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1c(F)cc(C(F)(F)F)cc1C(F)(F)F |
| Water Solubility | It reacts with water. |
| HS Code | 2916399090 |
|---|