6-(3,4-Dichlorophenyl)-2-methylpyrimidine-4-carboxylic acid
Modify Date: 2026-04-13 17:47:27
6-(3,4-Dichlorophenyl)-2-methylpyrimidine-4-carboxylic acid structure
|
Common Name | 6-(3,4-Dichlorophenyl)-2-methylpyrimidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1017438-16-2 | Molecular Weight | 283.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(3,4-Dichlorophenyl)-2-methylpyrimidine-4-carboxylic acid |
|---|
| Molecular Formula | C12H8Cl2N2O2 |
|---|---|
| Molecular Weight | 283.11 |
| InChIKey | MEHYKBDPIZEBAD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)C(=O)O)C2=CC(=C(C=C2)Cl)Cl |
|
Name: Inhibition of human KMO transfected in CHO cells assessed as conversion of kynurenine...
Source: ChEMBL
Target: Kynurenine 3-monooxygenase
External Id: CHEMBL3413143
|
|
Name: Inhibition of human KMO assessed as conversion of kynurenine to 3-hydroxykynurenine b...
Source: ChEMBL
Target: Kynurenine 3-monooxygenase
External Id: CHEMBL3413142
|
Total 2, Current Page 1 of 1
1