Benzenamine,2-(1H-naphth[1,2-d]imidazol-2-yl)- structure
|
Common Name | Benzenamine,2-(1H-naphth[1,2-d]imidazol-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 10173-59-8 | Molecular Weight | 259.30500 | |
| Density | 1.317g/cm3 | Boiling Point | 548.3ºC at 760mmHg | |
| Molecular Formula | C17H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.4ºC | |
| Name | 2-(3H-benzo[e]benzimidazol-2-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 548.3ºC at 760mmHg |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.30500 |
| Flash Point | 319.4ºC |
| Exact Mass | 259.11100 |
| PSA | 54.70000 |
| LogP | 4.54650 |
| Vapour Pressure | 4.48E-12mmHg at 25°C |
| Index of Refraction | 1.789 |
| InChIKey | DWBKTAXQSDQBOW-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1-c1nc2c(ccc3ccccc32)[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3H-naphtho[1,2-d]imidazol-2-yl)-aniline |
| 2-(o-aminophenyl)-(1H)-3H-naphth<1,2-d>imidazole |
| 2-(2-Amino-phenyl)-naphth<1,2-d>imidazol |