4-methoxy-2,5-dinitrobenzaldehyde
Modify Date: 2025-09-20 16:39:03
4-methoxy-2,5-dinitrobenzaldehyde structure
|
Common Name | 4-methoxy-2,5-dinitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 1017293-89-8 | Molecular Weight | 226.14300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxy-2,5-dinitrobenzaldehyde |
|---|
| Molecular Formula | C8H6N2O6 |
|---|---|
| Molecular Weight | 226.14300 |
| Exact Mass | 226.02300 |
| PSA | 117.94000 |
| LogP | 2.37050 |
| InChIKey | PQLAZBSCSHKYQT-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(C=O)cc1[N+](=O)[O-] |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |