methyl ethyl ketone 4-nitrophenylhydrazone structure
|
Common Name | methyl ethyl ketone 4-nitrophenylhydrazone | ||
|---|---|---|---|---|
| CAS Number | 1017-79-4 | Molecular Weight | 207.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl ethyl ketone 4-nitrophenylhydrazone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13N3O2 |
|---|---|
| Molecular Weight | 207.22900 |
| Exact Mass | 207.10100 |
| PSA | 70.21000 |
| LogP | 3.38880 |
| InChIKey | HCKKWFJUSMCMHZ-UHFFFAOYSA-N |
| SMILES | CCC(C)=NNc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| butan-2-one-(4-nitro-phenylhydrazone) |
| Butan-2-on-(4-nitro-phenylhydrazon) |
| Ethyl-methyl-keton-(4-nitro-phenylhydrazon) |
| Methyl-ethyl-keton-(4-nitro-phenylhydrazon) |
| 4-nitrophenylhydrazone of 2-butanone |
| Methylaethylketon-(4-nitro-phenylhydrazon) |