[(1R,5S)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate structure
|
Common Name | [(1R,5S)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 101691-39-8 | Molecular Weight | 390.43400 | |
| Density | 1.36g/cm3 | Boiling Point | 586.4ºC at 760 mmHg | |
| Molecular Formula | C19H26N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.5ºC | |
| Name | [(1R,5S)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 586.4ºC at 760 mmHg |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.43400 |
| Flash Point | 308.5ºC |
| Exact Mass | 390.19000 |
| PSA | 108.35000 |
| LogP | 0.47270 |
| Vapour Pressure | 1.35E-14mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | GNNTZHHHCVKACU-QWHCGFSZSA-N |
| SMILES | CC1=CCC(C(C)(C)O)CC1OC(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| Theophylline-7-acetic acid ester of d,l-trans-sobrerol |
| CO/1488 |
| 7H-Purine-7-acetic acid,1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-,5-(1-hydroxy-1-methylethyl)-2-methyl-2-cyclohexen-1-yl ester,trans-(+-) |