methyl 4-hydroxy-3-(3-methylbut-2-enyl)benzoate
Modify Date: 2025-10-03 19:13:36
methyl 4-hydroxy-3-(3-methylbut-2-enyl)benzoate structure
|
Common Name | methyl 4-hydroxy-3-(3-methylbut-2-enyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 101511-34-6 | Molecular Weight | 220.26400 | |
| Density | 1.093g/cm3 | Boiling Point | 347.1ºC at 760mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.9ºC | |
| Name | methyl 4-hydroxy-3-(3-methylbut-2-enyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 347.1ºC at 760mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 143.9ºC |
| Exact Mass | 220.11000 |
| PSA | 46.53000 |
| LogP | 2.68750 |
| Vapour Pressure | 2.75E-05mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | VTTIBUAIXVAPKR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(O)c(CC=C(C)C)c1 |
|
~%
methyl 4-hydrox... CAS#:101511-34-6 |
| Literature: Nicolaou; Pfefferkorn; Roecker; Cao; Barluenga; Mitchell Journal of the American Chemical Society, 2000 , vol. 122, # 41 p. 9939 - 9953 |
|
~%
methyl 4-hydrox... CAS#:101511-34-6 |
| Literature: Nicolaou; Pfefferkorn; Roecker; Cao; Barluenga; Mitchell Journal of the American Chemical Society, 2000 , vol. 122, # 41 p. 9939 - 9953 |
|
~%
methyl 4-hydrox... CAS#:101511-34-6 |
| Literature: Zdero, C.; Bohlmann, F.; Anderberg, A. Phytochemistry (Elsevier), 1991 , vol. 30, # 8 p. 2703 - 2706 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:34818-57-0| Benzoic acid,4-hydroxy-3-(3-methyl-2-buten-1-yl)-,methyl ester |
| methyl-4-hydroxy-3-prenylbenzoate |
| methyl 4-hydroxy-3-(3'-methyl-2'-butenyl)benzoate |