4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-fluoroaniline structure
|
Common Name | 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-fluoroaniline | ||
|---|---|---|---|---|
| CAS Number | 101463-63-2 | Molecular Weight | 305.65500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8ClF4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-fluoroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8ClF4NO |
|---|---|
| Molecular Weight | 305.65500 |
| Exact Mass | 305.02300 |
| PSA | 35.25000 |
| LogP | 5.45360 |
| InChIKey | VJDSJZLFFLFXEQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1F |
|
~%
4-[2-chloro-4-(... CAS#:101463-63-2 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4745113 A1, 1988 ; |
|
~52%
4-[2-chloro-4-(... CAS#:101463-63-2 |
| Literature: Wang, Shuo; Allan, Robin D.; Skerritt, John H.; Kennedy, Ivan R. Journal of Agricultural and Food Chemistry, 1999 , vol. 47, # 8 p. 3416 - 3424 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(2-chloro-4-(trifluoromethyl)-phenoxy)-2-fluoroaniline |
| 2-fluoro-4-(2-chloro-4-[trifluoromethyl]phenoxy)aniline |
| Benzenamine,4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-fluoro |