2H-Isoindole-2-aceticacid, 1,3-dihydro-5-nitro-1,3-dioxo- structure
|
Common Name | 2H-Isoindole-2-aceticacid, 1,3-dihydro-5-nitro-1,3-dioxo- | ||
|---|---|---|---|---|
| CAS Number | 10133-88-7 | Molecular Weight | 250.16400 | |
| Density | 1.706g/cm3 | Boiling Point | 504.5ºC at 760 mmHg | |
| Molecular Formula | C10H6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.9ºC | |
| Name | 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.706g/cm3 |
|---|---|
| Boiling Point | 504.5ºC at 760 mmHg |
| Molecular Formula | C10H6N2O6 |
| Molecular Weight | 250.16400 |
| Flash Point | 258.9ºC |
| Exact Mass | 250.02300 |
| PSA | 120.50000 |
| LogP | 0.73650 |
| Vapour Pressure | 5.33E-11mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | IYUGAIHDSMCVCC-UHFFFAOYSA-N |
| SMILES | O=C(O)CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-nitrophthalimidoacetic acid |
| 2-(5-nitro-1,3-dioxo-1,3-dihydro-(2H)-isoindole-2-yl)ethanoicacid |
| N,N-(4-nitro-phthaloyl)-glycine |
| 2-(4-nitrophthalimido)acetic acid |
| 2-(5-nitro-1,3-dioxoisoindolin-2-yl)acetic acid |
| 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetic acid |
| (5-nitro-1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid(SALTDATA: FREE) |