2-[4-(3-hydroxy-3-methylbutyl)phenoxy]acetic acid
Modify Date: 2025-08-25 12:46:52
![2-[4-(3-hydroxy-3-methylbutyl)phenoxy]acetic acid Structure](https://image.chemsrc.com/caspic/497/101268-32-0.png)
2-[4-(3-hydroxy-3-methylbutyl)phenoxy]acetic acid structure
|
Common Name | 2-[4-(3-hydroxy-3-methylbutyl)phenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 101268-32-0 | Molecular Weight | 238.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(3-hydroxy-3-methylbutyl)phenoxy]acetic acid |
|---|
| Molecular Formula | C13H18O4 |
|---|---|
| Molecular Weight | 238.28000 |
| Exact Mass | 238.12100 |
| PSA | 66.76000 |
| LogP | 1.85350 |
| InChIKey | WBFGIKRJLHVCOF-UHFFFAOYSA-N |
| SMILES | CC(C)(O)CCc1ccc(OCC(=O)O)cc1 |
|
~%
2-[4-(3-hydroxy... CAS#:101268-32-0 |
| Literature: Akaji, Kenichi; Kiso, Yoshiaki; Carpino, Louis A. Journal of the Chemical Society, Chemical Communications, 1990 , # 7 p. 584 - 586 |
|
~%
2-[4-(3-hydroxy... CAS#:101268-32-0 |
| Literature: Kochansky; Wagner Tetrahedron Letters, 1992 , vol. 33, # 52 p. 8007 - 8010 |
|
~%
2-[4-(3-hydroxy... CAS#:101268-32-0 |
| Literature: Akaji, Kenichi; Kiso, Yoshiaki; Carpino, Louis A. Journal of the Chemical Society, Chemical Communications, 1990 , # 7 p. 584 - 586 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |