tert-butyl N-acetyl-N-(2-phenylethyl)carbamate
Modify Date: 2025-10-09 20:28:15
tert-butyl N-acetyl-N-(2-phenylethyl)carbamate structure
|
Common Name | tert-butyl N-acetyl-N-(2-phenylethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 101137-71-7 | Molecular Weight | 263.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-acetyl-N-(2-phenylethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H21NO3 |
|---|---|
| Molecular Weight | 263.33200 |
| Exact Mass | 263.15200 |
| PSA | 46.61000 |
| LogP | 3.01270 |
| InChIKey | HWACZKUOYZZWEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)N(CCc1ccccc1)C(=O)OC(C)(C)C |
|
~%
tert-butyl N-ac... CAS#:101137-71-7 |
| Literature: Grehn, Leif; Gunnarsson, Kerstin; Ragnarsson, Ulf Journal of the Chemical Society, Chemical Communications, 1985 , # 19 p. 1317 - 1318 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Carbamic acid,acetyl(2-phenylethyl)-,1,1-dimethylethyl ester |