4-(3-Oxo-3-phenylprop-1-enyl)phenyl 4-fluorobenzene-1-sulfonate
Modify Date: 2026-05-12 17:35:08
4-(3-Oxo-3-phenylprop-1-enyl)phenyl 4-fluorobenzene-1-sulfonate structure
|
Common Name | 4-(3-Oxo-3-phenylprop-1-enyl)phenyl 4-fluorobenzene-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 1010118-48-5 | Molecular Weight | 382.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15FO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-Oxo-3-phenylprop-1-enyl)phenyl 4-fluorobenzene-1-sulfonate |
|---|
| Molecular Formula | C21H15FO4S |
|---|---|
| Molecular Weight | 382.4 |
| InChIKey | YMOCKJOIASMJTF-OVCLIPMQSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)OS(=O)(=O)C3=CC=C(C=C3)F |
|
Name: Blockade of human K+ channel in HEK293 cells assessed as inhibition of outward delaye...
Source: ChEMBL
Target: N/A
External Id: CHEMBL928773
|
Total 1, Current Page 1 of 1
1