diperodon
Modify Date: 2025-08-25 07:15:16
diperodon structure
|
Common Name | diperodon | ||
|---|---|---|---|---|
| CAS Number | 101-08-6 | Molecular Weight | 397.46700 | |
| Density | N/A | Boiling Point | 502ºC at 760mmHg | |
| Molecular Formula | C22H27N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.4ºC | |
| Name | [2-(phenylcarbamoyloxy)-3-piperidin-1-ylpropyl] N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 502ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.46700 |
| Flash Point | 257.4ºC |
| Exact Mass | 397.20000 |
| PSA | 79.90000 |
| LogP | 4.42220 |
| Vapour Pressure | 3.3E-10mmHg at 25°C |
| InChIKey | YUGZHQHSNYIFLG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)OCC(CN1CCCCC1)OC(=O)Nc1ccccc1 |
| HS Code | 2933399090 |
|---|
|
~%
diperodon CAS#:101-08-6 |
| Literature: Rieder Journal of the American Chemical Society, 1930 , vol. 52, p. 2115,2117 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-bis-phenylcarbamoyloxy-3-piperidino-propane |
| Diperodonum |
| Diperodonum [INN-Latin] |
| 1,2-bis-phenylcarbamoyloxy-3-piperidin-1-yl-propane |
| (+-)-1,2-Bis-phenylcarbamoyloxy-3-piperidino-propan |
| Diperodon |
| UNII-UIN4PYP84R |
| 1,2-Propanediol,3-(1-piperidinyl)-,bis(phenylcarbamate) |