N,N'-bis(2-chloroethyl)-N,N'-dimethylbutane-1,4-diamine oxide structure
|
Common Name | N,N'-bis(2-chloroethyl)-N,N'-dimethylbutane-1,4-diamine oxide | ||
|---|---|---|---|---|
| CAS Number | 100991-86-4 | Molecular Weight | 273.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H22Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-bis(2-chloroethyl)-N,N'-dimethylbutane-1,4-diamine oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H22Cl2N2O2 |
|---|---|
| Molecular Weight | 273.20000 |
| Exact Mass | 272.10600 |
| PSA | 58.86000 |
| LogP | 2.17480 |
| InChIKey | HDWUFYXLEHTFHM-UHFFFAOYSA-N |
| SMILES | C[N+]([O-])(CCCl)CCCC[N+](C)([O-])CCCl |
|
~%
N,N'-bis(2-chlo... CAS#:100991-86-4 |
| Literature: Ishidate et al. Chemical and Pharmaceutical Bulletin, 1958 , vol. 6, p. 164,168 |
|
~%
N,N'-bis(2-chlo... CAS#:100991-86-4 |
| Literature: Ishidate et al. Chemical and Pharmaceutical Bulletin, 1958 , vol. 6, p. 164,168 |
|
~%
N,N'-bis(2-chlo... CAS#:100991-86-4 |
| Literature: Ishidate et al. Chemical and Pharmaceutical Bulletin, 1958 , vol. 6, p. 164,168 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-BUTANEDIAMINE,N,N'-BIS(2-CHLOROETHYL)-N,N'-DIMETHYL-,N,N'-DIOXIDE |
| N,N'-Bis-(2-chlor-aethyl)-N,N'-dimethyl-butandiyldiamin-N,N'-dioxid |
| N,N'-bis-(2-chloro-ethyl)-N,N'-dimethyl-butanediyldiamine-N,N'-dioxide |
| N,N'-Bis(2-chloroethyl)-N,N'-dimethyl-1,4-butanediamine N,N'-dioxide |