1-benzyloxy-4-methyl-2-nitro-benzene
Modify Date: 2025-08-30 06:33:29
1-benzyloxy-4-methyl-2-nitro-benzene structure
|
Common Name | 1-benzyloxy-4-methyl-2-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 100866-84-0 | Molecular Weight | 243.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzyloxy-4-methyl-2-nitro-benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO3 |
|---|---|
| Molecular Weight | 243.25800 |
| Exact Mass | 243.09000 |
| PSA | 55.05000 |
| LogP | 4.00540 |
| InChIKey | SQMZODGIHXHNAW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCc2ccccc2)c([N+](=O)[O-])c1 |
|
~%
1-benzyloxy-4-m... CAS#:100866-84-0 |
| Literature: Tetrahedron Letters, , vol. 53, # 52 p. 7036 - 7039 |
|
~%
1-benzyloxy-4-m... CAS#:100866-84-0 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 224, p. 138 |
|
~%
1-benzyloxy-4-m... CAS#:100866-84-0 |
| Literature: Journal of the Chemical Society, , p. 267,269 Journal of the Chemical Society, , p. 676 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| benzyl-(4-methyl-[2]quinolyl)-amine |
| benzyl-(4-methoxy-benzyl)-(2-piperidino-ethyl)-amine,dihydrochloride |
| N-benzyl-N-[(4-methoxyphenyl)methyl]-2-piperidin-1-ylethanamine dihydrochloride |
| 1-benzyloxy-4-methyl-2-nitrobenzene |
| Benzyl-(4-methyl-[2]chinolyl)-amin |
| 2-benzylamino-4-methylquinoline |
| 3-Nitro-4-benzyloxy-toluol |
| Benzyl-(4-methyl-2-nitro-phenyl)-aether |
| Benzyl-(4-methoxy-benzyl)-(2-piperidino-aethyl)-amin,Dihydrochlorid |
| Piperidine,1-(2-(benzyl(p-methoxybenzyl)amino)ethyl)-,dihydrochloride |
| 1-(2-(Benzyl(p-methoxybenzyl)amino)ethyl)piperidine dihydrochloride |
| benzyl-(4-methyl-2-nitro-phenyl)-ether |